C19H17BrN2OS — CID 43944854
N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)acetamide (PubChem CID 43944854) has the molecular formula C19H17BrN2OS and a molecular weight of 401.33 g/mol. Its IUPAC name is N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)acetamide.
| Compound Name | N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43944854 |
| Molecular Formula | C19H17BrN2OS |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)Cc2ccc(C)cc2)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C19H17BrN2OS/c1-3-10-22-16-9-8-15(20)12-17(16)24-19(22)21-18(23)11-14-6-4-13(2)5-7-14/h3-9,12H,1,10-11H2,2H3/b21-19- |
| InChIKey | SSIRFBQIYVKXRW-VZCXRCSSSA-N |
| XLogP | 4.63 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|