C20H21N3O3S2 — CID 43944882
2-(4-ethylphenyl)-N-(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 43944882) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-N-(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-(4-ethylphenyl)-N-(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 43944882 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-(4-ethylphenyl)-N-(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)Cc2ccc(CC)cc2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H21N3O3S2/c1-3-11-23-17-10-9-16(28(21,25)26)13-18(17)27-20(23)22-19(24)12-15-7-5-14(4-2)6-8-15/h3,5-10,13H,1,4,11-12H2,2H3,(H2,21,25,26)/b22-20- |
| InChIKey | VFCFPCJUOVHTCS-XDOYNYLZSA-N |
| XLogP | 2.77 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|