C19H17N3O5S2 — CID 43942908
methyl 2-[(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)carbamoyl]benzoate (PubChem CID 43942908) has the molecular formula C19H17N3O5S2 and a molecular weight of 431.50 g/mol. Its IUPAC name is methyl 2-[(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)carbamoyl]benzoate.
| Compound Name | methyl 2-[(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)carbamoyl]benzoate |
|---|---|
| PubChem CID | 43942908 |
| Molecular Formula | C19H17N3O5S2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | methyl 2-[(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)carbamoyl]benzoate |
| SMILES | C=CCn1/c(=N/C(=O)c2ccccc2C(=O)OC)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C19H17N3O5S2/c1-3-10-22-15-9-8-12(29(20,25)26)11-16(15)28-19(22)21-17(23)13-6-4-5-7-14(13)18(24)27-2/h3-9,11H,1,10H2,2H3,(H2,20,25,26)/b21-19- |
| InChIKey | OSCUUYPJODUDSD-VZCXRCSSSA-N |
| XLogP | 2.06 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|