C19H17N3O5S2 — CID 41126809
2-(4-methylsulfonylphenyl)-N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 41126809) has the molecular formula C19H17N3O5S2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)-N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-(4-methylsulfonylphenyl)-N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 41126809 |
| Molecular Formula | C19H17N3O5S2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)-N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)Cc2ccc(S(C)(=O)=O)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C19H17N3O5S2/c1-3-10-21-16-9-6-14(22(24)25)12-17(16)28-19(21)20-18(23)11-13-4-7-15(8-5-13)29(2,26)27/h3-9,12H,1,10-11H2,2H3/b20-19- |
| InChIKey | USRBSULQSBRULI-VXPUYCOJSA-N |
| XLogP | 2.87 |
| TPSA | 111.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|