C21H21FN2OS — CID 43944830
N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(2,4,6-trimethylphenyl)acetamide (PubChem CID 43944830) has the molecular formula C21H21FN2OS and a molecular weight of 368.48 g/mol. Its IUPAC name is N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 43944830 |
| Molecular Formula | C21H21FN2OS |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(2,4,6-trimethylphenyl)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)Cc2c(C)cc(C)cc2C)sc2cc(F)ccc21 |
| InChI | InChI=1S/C21H21FN2OS/c1-5-8-24-18-7-6-16(22)11-19(18)26-21(24)23-20(25)12-17-14(3)9-13(2)10-15(17)4/h5-7,9-11H,1,8,12H2,2-4H3/b23-21- |
| InChIKey | LXECZIXHXIFHRK-LNVKXUELSA-N |
| XLogP | 4.62 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|