C18H21FN2OS — CID 43942835
3-cyclopentyl-N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)propanamide (PubChem CID 43942835) has the molecular formula C18H21FN2OS and a molecular weight of 332.44 g/mol. Its IUPAC name is 3-cyclopentyl-N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)propanamide.
| Compound Name | 3-cyclopentyl-N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)propanamide |
|---|---|
| PubChem CID | 43942835 |
| Molecular Formula | C18H21FN2OS |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 3-cyclopentyl-N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)propanamide |
| SMILES | C=CCn1/c(=N/C(=O)CCC2CCCC2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C18H21FN2OS/c1-2-11-21-15-9-8-14(19)12-16(15)23-18(21)20-17(22)10-7-13-5-3-4-6-13/h2,8-9,12-13H,1,3-7,10-11H2/b20-18- |
| InChIKey | IZUKIEOITUZPKN-ZZEZOPTASA-N |
| XLogP | 4.43 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|