C20H19FN2OS — CID 41019387
N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-fluorophenyl)acetamide (PubChem CID 41019387) has the molecular formula C20H19FN2OS and a molecular weight of 354.45 g/mol. Its IUPAC name is N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-fluorophenyl)acetamide.
| Compound Name | N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 41019387 |
| Molecular Formula | C20H19FN2OS |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-fluorophenyl)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)Cc2ccc(F)cc2)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C20H19FN2OS/c1-4-9-23-17-11-13(2)10-14(3)19(17)25-20(23)22-18(24)12-15-5-7-16(21)8-6-15/h4-8,10-11H,1,9,12H2,2-3H3/b22-20- |
| InChIKey | GNRKGARIORHULY-XDOYNYLZSA-N |
| XLogP | 4.31 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|