C21H23BrN2O4S — CID 16912636
N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(2,4-dimethoxyphenyl)acetamide (PubChem CID 16912636) has the molecular formula C21H23BrN2O4S and a molecular weight of 479.40 g/mol. Its IUPAC name is N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16912636 |
| Molecular Formula | C21H23BrN2O4S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(2,4-dimethoxyphenyl)acetamide |
| SMILES | CCOCCn1/c(=N/C(=O)Cc2ccc(OC)cc2OC)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C21H23BrN2O4S/c1-4-28-10-9-24-17-8-6-15(22)12-19(17)29-21(24)23-20(25)11-14-5-7-16(26-2)13-18(14)27-3/h5-8,12-13H,4,9-11H2,1-3H3/b23-21- |
| InChIKey | KIJKWHMGVGPPBG-LNVKXUELSA-N |
| XLogP | 4.19 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|