C16H21BrN2O2S — CID 4525436
N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2,2-dimethylpropanamide (PubChem CID 4525436) has the molecular formula C16H21BrN2O2S and a molecular weight of 385.33 g/mol. Its IUPAC name is N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2,2-dimethylpropanamide.
| Compound Name | N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 4525436 |
| Molecular Formula | C16H21BrN2O2S |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2,2-dimethylpropanamide |
| SMILES | CCOCCn1/c(=N/C(=O)C(C)(C)C)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C16H21BrN2O2S/c1-5-21-9-8-19-12-7-6-11(17)10-13(12)22-15(19)18-14(20)16(2,3)4/h6-7,10H,5,8-9H2,1-4H3/b18-15- |
| InChIKey | SAUMADNGFAGPHQ-SDXDJHTJSA-N |
| XLogP | 3.98 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|