C22H26N2O4S — CID 16848926
N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]-2,5-dimethoxybenzamide (PubChem CID 16848926) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]-2,5-dimethoxybenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 16848926 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]-2,5-dimethoxybenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc(OC)ccc2OC)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C22H26N2O4S/c1-6-28-10-9-24-18-12-14(2)11-15(3)20(18)29-22(24)23-21(25)17-13-16(26-4)7-8-19(17)27-5/h7-8,11-13H,6,9-10H2,1-5H3/b23-22- |
| InChIKey | RQCHTRMFDJMRDP-FCQUAONHSA-N |
| XLogP | 4.11 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|