C21H23ClN2O3S — CID 41202829
2-(4-chlorophenoxy)-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]acetamide (PubChem CID 41202829) has the molecular formula C21H23ClN2O3S and a molecular weight of 418.95 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]acetamide |
|---|---|
| PubChem CID | 41202829 |
| Molecular Formula | C21H23ClN2O3S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]acetamide |
| SMILES | CCOCCn1/c(=N/C(=O)COc2ccc(Cl)cc2)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C21H23ClN2O3S/c1-4-26-10-9-24-18-12-14(2)11-15(3)20(18)28-21(24)23-19(25)13-27-17-7-5-16(22)6-8-17/h5-8,11-12H,4,9-10,13H2,1-3H3/b23-21- |
| InChIKey | CXYJTWUMSJKPNV-LNVKXUELSA-N |
| XLogP | 4.52 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|