C23H28N2O4S — CID 43937492
N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2-(4-propan-2-ylphenoxy)acetamide (PubChem CID 43937492) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2-(4-propan-2-ylphenoxy)acetamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2-(4-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 43937492 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2-(4-propan-2-ylphenoxy)acetamide |
| SMILES | CCOCCn1/c(=N/C(=O)COc2ccc(C(C)C)cc2)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C23H28N2O4S/c1-5-28-13-12-25-20-11-10-19(27-4)14-21(20)30-23(25)24-22(26)15-29-18-8-6-17(7-9-18)16(2)3/h6-11,14,16H,5,12-13,15H2,1-4H3/b24-23- |
| InChIKey | XFEVKMXBXHDZGU-VHXPQNKSSA-N |
| XLogP | 4.38 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|