C26H26N2O3S — CID 4106626
N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2,2-diphenylacetamide (PubChem CID 4106626) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2,2-diphenylacetamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 4106626 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2,2-diphenylacetamide |
| SMILES | CCOCCn1/c(=N/C(=O)C(c2ccccc2)c2ccccc2)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C26H26N2O3S/c1-3-31-17-16-28-22-15-14-21(30-2)18-23(22)32-26(28)27-25(29)24(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15,18,24H,3,16-17H2,1-2H3/b27-26- |
| InChIKey | GQUDMLGGBIBZIF-RQZHXJHFSA-N |
| XLogP | 5.01 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|