C28H28N2O4S — CID 3275298
ethyl 2-(2,2-diphenylacetyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate (PubChem CID 3275298) has the molecular formula C28H28N2O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is ethyl 2-(2,2-diphenylacetyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-(2,2-diphenylacetyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3275298 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | ethyl 2-(2,2-diphenylacetyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)C(c2ccccc2)c2ccccc2)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C28H28N2O4S/c1-3-33-18-17-30-23-16-15-22(27(32)34-4-2)19-24(23)35-28(30)29-26(31)25(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-16,19,25H,3-4,17-18H2,1-2H3/b29-28- |
| InChIKey | YJFQRQCRYVAYRH-ZIADKAODSA-N |
| XLogP | 5.18 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|