C22H23FN2O5S — CID 43937301
ethyl 3-(2-ethoxyethyl)-2-[2-(2-fluorophenoxy)acetyl]imino-1,3-benzothiazole-6-carboxylate (PubChem CID 43937301) has the molecular formula C22H23FN2O5S and a molecular weight of 446.50 g/mol. Its IUPAC name is ethyl 3-(2-ethoxyethyl)-2-[2-(2-fluorophenoxy)acetyl]imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 3-(2-ethoxyethyl)-2-[2-(2-fluorophenoxy)acetyl]imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 43937301 |
| Molecular Formula | C22H23FN2O5S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | ethyl 3-(2-ethoxyethyl)-2-[2-(2-fluorophenoxy)acetyl]imino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)COc2ccccc2F)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C22H23FN2O5S/c1-3-28-12-11-25-17-10-9-15(21(27)29-4-2)13-19(17)31-22(25)24-20(26)14-30-18-8-6-5-7-16(18)23/h5-10,13H,3-4,11-12,14H2,1-2H3/b24-22- |
| InChIKey | UZSPCQPYIOUNMV-GYHWCHFESA-N |
| XLogP | 3.56 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|