C22H26N2O2S — CID 41203555
N-[3-(2-ethoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-2,4-dimethylbenzamide (PubChem CID 41203555) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-2,4-dimethylbenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 41203555 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-2,4-dimethylbenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(C)cc2C)sc2cc(C)cc(C)c21 |
| InChI | InChI=1S/C22H26N2O2S/c1-6-26-10-9-24-20-17(5)12-15(3)13-19(20)27-22(24)23-21(25)18-8-7-14(2)11-16(18)4/h7-8,11-13H,6,9-10H2,1-5H3/b23-22- |
| InChIKey | MLOZYLASYSZGIT-FCQUAONHSA-N |
| XLogP | 4.71 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|