C28H29N3O3S2 — CID 43944562
4-[benzyl(ethyl)sulfamoyl]-N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43944562) has the molecular formula C28H29N3O3S2 and a molecular weight of 519.69 g/mol. Its IUPAC name is 4-[benzyl(ethyl)sulfamoyl]-N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[benzyl(ethyl)sulfamoyl]-N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43944562 |
| Molecular Formula | C28H29N3O3S2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 4-[benzyl(ethyl)sulfamoyl]-N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CC)Cc3ccccc3)cc2)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C28H29N3O3S2/c1-5-16-31-25-18-20(3)17-21(4)26(25)35-28(31)29-27(32)23-12-14-24(15-13-23)36(33,34)30(6-2)19-22-10-8-7-9-11-22/h5,7-15,17-18H,1,6,16,19H2,2-4H3/b29-28- |
| InChIKey | WUHWOCXNLXBBTN-ZIADKAODSA-N |
| XLogP | 5.46 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|