C26H24BrN3O3S2 — CID 4106502
4-[benzyl(ethyl)sulfamoyl]-N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 4106502) has the molecular formula C26H24BrN3O3S2 and a molecular weight of 570.53 g/mol. Its IUPAC name is 4-[benzyl(ethyl)sulfamoyl]-N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[benzyl(ethyl)sulfamoyl]-N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 4106502 |
| Molecular Formula | C26H24BrN3O3S2 |
| Molecular Weight | 570.53 g/mol |
| Exact Mass | 569.04 |
| IUPAC Name | 4-[benzyl(ethyl)sulfamoyl]-N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CC)Cc3ccccc3)cc2)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C26H24BrN3O3S2/c1-3-16-30-23-15-12-21(27)17-24(23)34-26(30)28-25(31)20-10-13-22(14-11-20)35(32,33)29(4-2)18-19-8-6-5-7-9-19/h3,5-15,17H,1,4,16,18H2,2H3/b28-26- |
| InChIKey | TZTFDHSTSZYVGA-SGEDCAFJSA-N |
| XLogP | 5.60 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|