C27H26N4O7S2 — CID 5054994
ethyl 2-[2-[4-[benzyl(ethyl)sulfamoyl]benzoyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 5054994) has the molecular formula C27H26N4O7S2 and a molecular weight of 582.66 g/mol. Its IUPAC name is ethyl 2-[2-[4-[benzyl(ethyl)sulfamoyl]benzoyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[4-[benzyl(ethyl)sulfamoyl]benzoyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 5054994 |
| Molecular Formula | C27H26N4O7S2 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.12 |
| IUPAC Name | ethyl 2-[2-[4-[benzyl(ethyl)sulfamoyl]benzoyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CC)Cc3ccccc3)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C27H26N4O7S2/c1-3-29(17-19-8-6-5-7-9-19)40(36,37)22-13-10-20(11-14-22)26(33)28-27-30(18-25(32)38-4-2)23-15-12-21(31(34)35)16-24(23)39-27/h5-16H,3-4,17-18H2,1-2H3/b28-27- |
| InChIKey | RPVXIQMZAHWHCH-DQSJHHFOSA-N |
| XLogP | 4.13 |
| TPSA | 141.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|