C26H22N4O5S2 — CID 16851994
4-[benzyl(ethyl)sulfamoyl]-N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 16851994) has the molecular formula C26H22N4O5S2 and a molecular weight of 534.62 g/mol. Its IUPAC name is 4-[benzyl(ethyl)sulfamoyl]-N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[benzyl(ethyl)sulfamoyl]-N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 16851994 |
| Molecular Formula | C26H22N4O5S2 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 4-[benzyl(ethyl)sulfamoyl]-N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CC)Cc3ccccc3)cc2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C26H22N4O5S2/c1-3-16-29-23-17-21(30(32)33)12-15-24(23)36-26(29)27-25(31)20-10-13-22(14-11-20)37(34,35)28(4-2)18-19-8-6-5-7-9-19/h1,5-15,17H,4,16,18H2,2H3/b27-26- |
| InChIKey | CSKHXDGPXVRVHL-RQZHXJHFSA-N |
| XLogP | 4.20 |
| TPSA | 114.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|