C25H24N4O6S2 — CID 16851101
4-[ethyl(phenyl)sulfamoyl]-N-[3-(2-methoxyethyl)-5-nitro-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 16851101) has the molecular formula C25H24N4O6S2 and a molecular weight of 540.62 g/mol. Its IUPAC name is 4-[ethyl(phenyl)sulfamoyl]-N-[3-(2-methoxyethyl)-5-nitro-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-[ethyl(phenyl)sulfamoyl]-N-[3-(2-methoxyethyl)-5-nitro-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 16851101 |
| Molecular Formula | C25H24N4O6S2 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | 4-[ethyl(phenyl)sulfamoyl]-N-[3-(2-methoxyethyl)-5-nitro-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3ccc([N+](=O)[O-])cc3n2CCOC)cc1 |
| InChI | InChI=1S/C25H24N4O6S2/c1-3-28(19-7-5-4-6-8-19)37(33,34)21-12-9-18(10-13-21)24(30)26-25-27(15-16-35-2)22-17-20(29(31)32)11-14-23(22)36-25/h4-14,17H,3,15-16H2,1-2H3/b26-25- |
| InChIKey | BTYHIAOVJNUQSJ-QPLCGJKRSA-N |
| XLogP | 4.21 |
| TPSA | 124.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|