C24H22N4O5S2 — CID 16850912
N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-4-[ethyl(phenyl)sulfamoyl]benzamide (PubChem CID 16850912) has the molecular formula C24H22N4O5S2 and a molecular weight of 510.60 g/mol. Its IUPAC name is N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-4-[ethyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-4-[ethyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 16850912 |
| Molecular Formula | C24H22N4O5S2 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-4-[ethyl(phenyl)sulfamoyl]benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3ccc([N+](=O)[O-])cc3n2CC)cc1 |
| InChI | InChI=1S/C24H22N4O5S2/c1-3-26-21-16-19(28(30)31)12-15-22(21)34-24(26)25-23(29)17-10-13-20(14-11-17)35(32,33)27(4-2)18-8-6-5-7-9-18/h5-16H,3-4H2,1-2H3/b25-24- |
| InChIKey | UFDSYJZSKMBQPT-IZHYLOQSSA-N |
| XLogP | 4.59 |
| TPSA | 114.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|