C27H25N3O3S2 — CID 40997071
4-[benzyl(methyl)sulfamoyl]-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 40997071) has the molecular formula C27H25N3O3S2 and a molecular weight of 503.65 g/mol. Its IUPAC name is 4-[benzyl(methyl)sulfamoyl]-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[benzyl(methyl)sulfamoyl]-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 40997071 |
| Molecular Formula | C27H25N3O3S2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 4-[benzyl(methyl)sulfamoyl]-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(C)Cc3ccccc3)cc2)sc2cc(CC)ccc21 |
| InChI | InChI=1S/C27H25N3O3S2/c1-4-17-30-24-16-11-20(5-2)18-25(24)34-27(30)28-26(31)22-12-14-23(15-13-22)35(32,33)29(3)19-21-9-7-6-8-10-21/h1,6-16,18H,5,17,19H2,2-3H3/b28-27- |
| InChIKey | RLTAPMZHTYSLNK-DQSJHHFOSA-N |
| XLogP | 4.46 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|