C23H26BrN3O3S2 — CID 4990493
N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-(dipropylsulfamoyl)benzamide (PubChem CID 4990493) has the molecular formula C23H26BrN3O3S2 and a molecular weight of 536.52 g/mol. Its IUPAC name is N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-(dipropylsulfamoyl)benzamide.
| Compound Name | N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-(dipropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 4990493 |
| Molecular Formula | C23H26BrN3O3S2 |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-(dipropylsulfamoyl)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CCC)CCC)cc2)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C23H26BrN3O3S2/c1-4-13-26(14-5-2)32(29,30)19-10-7-17(8-11-19)22(28)25-23-27(15-6-3)20-12-9-18(24)16-21(20)31-23/h6-12,16H,3-5,13-15H2,1-2H3/b25-23- |
| InChIKey | HYYDAQXLYOJYSQ-BZZOAKBMSA-N |
| XLogP | 5.20 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|