C20H18N2O5S2 — CID 41135213
ethyl 3-[6-[(E)-3-thiophen-2-ylprop-2-enoyl]imino-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-yl]propanoate (PubChem CID 41135213) has the molecular formula C20H18N2O5S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is ethyl 3-[6-[(E)-3-thiophen-2-ylprop-2-enoyl]imino-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-yl]propanoate.
| Compound Name | ethyl 3-[6-[(E)-3-thiophen-2-ylprop-2-enoyl]imino-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-yl]propanoate |
|---|---|
| PubChem CID | 41135213 |
| Molecular Formula | C20H18N2O5S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | ethyl 3-[6-[(E)-3-thiophen-2-ylprop-2-enoyl]imino-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-yl]propanoate |
| SMILES | CCOC(=O)CCn1/c(=N/C(=O)/C=C/c2cccs2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C20H18N2O5S2/c1-2-25-19(24)7-8-22-14-10-15-16(27-12-26-15)11-17(14)29-20(22)21-18(23)6-5-13-4-3-9-28-13/h3-6,9-11H,2,7-8,12H2,1H3/b6-5+,21-20- |
| InChIKey | IRHNQBFYFNRNAS-NKMMNDJQSA-N |
| XLogP | 3.59 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|