C17H12ClN3O3S2 — CID 5044001
N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide (PubChem CID 5044001) has the molecular formula C17H12ClN3O3S2 and a molecular weight of 405.89 g/mol. Its IUPAC name is N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide.
| Compound Name | N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 5044001 |
| Molecular Formula | C17H12ClN3O3S2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide |
| SMILES | C=CCn1/c(=N/C(=O)C=Cc2ccc([N+](=O)[O-])s2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H12ClN3O3S2/c1-2-9-20-13-6-3-11(18)10-14(13)26-17(20)19-15(22)7-4-12-5-8-16(25-12)21(23)24/h2-8,10H,1,9H2/b7-4?,19-17- |
| InChIKey | CSGNFXKRWKNXQU-IHRXNNLMSA-N |
| XLogP | 4.65 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|