C17H11F2N3O3S2 — CID 43943581
(E)-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide (PubChem CID 43943581) has the molecular formula C17H11F2N3O3S2 and a molecular weight of 407.42 g/mol. Its IUPAC name is (E)-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 43943581 |
| Molecular Formula | C17H11F2N3O3S2 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | (E)-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide |
| SMILES | C=CCn1/c(=N/C(=O)/C=C/c2ccc([N+](=O)[O-])s2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C17H11F2N3O3S2/c1-2-7-21-16-12(19)8-10(18)9-13(16)27-17(21)20-14(23)5-3-11-4-6-15(26-11)22(24)25/h2-6,8-9H,1,7H2/b5-3+,20-17- |
| InChIKey | IOYUMFFPWUTPIO-MJFSOXTRSA-N |
| XLogP | 4.28 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|