C14H12F2N2OS — CID 4152860
N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)cyclopropanecarboxamide (PubChem CID 4152860) has the molecular formula C14H12F2N2OS and a molecular weight of 294.33 g/mol. Its IUPAC name is N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)cyclopropanecarboxamide.
| Compound Name | N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 4152860 |
| Molecular Formula | C14H12F2N2OS |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)cyclopropanecarboxamide |
| SMILES | C=CCn1/c(=N/C(=O)C2CC2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C14H12F2N2OS/c1-2-5-18-12-10(16)6-9(15)7-11(12)20-14(18)17-13(19)8-3-4-8/h2,6-8H,1,3-5H2/b17-14- |
| InChIKey | BQJLHGINOBWWPC-VKAVYKQESA-N |
| XLogP | 3.00 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|