C21H18ClF2N3O3S2 — CID 16924814
1-(4-chlorophenyl)sulfonyl-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)pyrrolidine-2-carboxamide (PubChem CID 16924814) has the molecular formula C21H18ClF2N3O3S2 and a molecular weight of 497.98 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 16924814 |
| Molecular Formula | C21H18ClF2N3O3S2 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)pyrrolidine-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)C2CCCN2S(=O)(=O)c2ccc(Cl)cc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C21H18ClF2N3O3S2/c1-2-9-26-19-16(24)11-14(23)12-18(19)31-21(26)25-20(28)17-4-3-10-27(17)32(29,30)15-7-5-13(22)6-8-15/h2,5-8,11-12,17H,1,3-4,9-10H2/b25-21- |
| InChIKey | DVMRJEKYBFFHFP-DAFNUICNSA-N |
| XLogP | 4.10 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|