C17H10Cl2F2N2OS — CID 3611708
2,4-dichloro-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 3611708) has the molecular formula C17H10Cl2F2N2OS and a molecular weight of 399.25 g/mol. Its IUPAC name is 2,4-dichloro-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 2,4-dichloro-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 3611708 |
| Molecular Formula | C17H10Cl2F2N2OS |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 2,4-dichloro-N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(Cl)cc2Cl)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C17H10Cl2F2N2OS/c1-2-5-23-15-13(21)7-10(20)8-14(15)25-17(23)22-16(24)11-4-3-9(18)6-12(11)19/h2-4,6-8H,1,5H2/b22-17- |
| InChIKey | WBSHBSUTXHGWNT-XLNRJJMWSA-N |
| XLogP | 5.21 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|