C15H9Cl2FN2OS2 — CID 3536157
2,5-dichloro-N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-3-carboxamide (PubChem CID 3536157) has the molecular formula C15H9Cl2FN2OS2 and a molecular weight of 387.29 g/mol. Its IUPAC name is 2,5-dichloro-N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 3536157 |
| Molecular Formula | C15H9Cl2FN2OS2 |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | 2,5-dichloro-N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-3-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(Cl)sc2Cl)sc2cccc(F)c21 |
| InChI | InChI=1S/C15H9Cl2FN2OS2/c1-2-6-20-12-9(18)4-3-5-10(12)22-15(20)19-14(21)8-7-11(16)23-13(8)17/h2-5,7H,1,6H2/b19-15- |
| InChIKey | ZYDRHCFZHUFPAY-CYVLTUHYSA-N |
| XLogP | 5.14 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|