C26H18FN3OS — CID 3342650
N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenylquinoline-4-carboxamide (PubChem CID 3342650) has the molecular formula C26H18FN3OS and a molecular weight of 439.52 g/mol. Its IUPAC name is N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3342650 |
| Molecular Formula | C26H18FN3OS |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenylquinoline-4-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(-c3ccccc3)nc3ccccc23)sc2cccc(F)c21 |
| InChI | InChI=1S/C26H18FN3OS/c1-2-15-30-24-20(27)12-8-14-23(24)32-26(30)29-25(31)19-16-22(17-9-4-3-5-10-17)28-21-13-7-6-11-18(19)21/h2-14,16H,1,15H2/b29-26- |
| InChIKey | ZMMUMBUKODCQAZ-WCTVFOPTSA-N |
| XLogP | 5.98 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|