C27H21N3O2S — CID 43944030
N-(4-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenylquinoline-4-carboxamide (PubChem CID 43944030) has the molecular formula C27H21N3O2S and a molecular weight of 451.55 g/mol. Its IUPAC name is N-(4-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(4-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 43944030 |
| Molecular Formula | C27H21N3O2S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-(4-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenylquinoline-4-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(-c3ccccc3)nc3ccccc23)sc2cccc(OC)c21 |
| InChI | InChI=1S/C27H21N3O2S/c1-3-16-30-25-23(32-2)14-9-15-24(25)33-27(30)29-26(31)20-17-22(18-10-5-4-6-11-18)28-21-13-8-7-12-19(20)21/h3-15,17H,1,16H2,2H3/b29-27- |
| InChIKey | ZYKHIHKLXKKTLP-OHYPFYFLSA-N |
| XLogP | 5.85 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|