C25H19N3O3S3 — CID 4189450
N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 4189450) has the molecular formula C25H19N3O3S3 and a molecular weight of 505.65 g/mol. Its IUPAC name is N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4189450 |
| Molecular Formula | C25H19N3O3S3 |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(-c3cccs3)nc3ccccc23)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C25H19N3O3S3/c1-3-12-28-21-11-10-16(34(2,30)31)14-23(21)33-25(28)27-24(29)18-15-20(22-9-6-13-32-22)26-19-8-5-4-7-17(18)19/h3-11,13-15H,1,12H2,2H3/b27-25- |
| InChIKey | HEUSCLZIGWYBPY-RFBIWTDZSA-N |
| XLogP | 5.31 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|