C25H19N3O2S2 — CID 3284692
N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 3284692) has the molecular formula C25H19N3O2S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3284692 |
| Molecular Formula | C25H19N3O2S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(-c3cccs3)nc3ccccc23)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C25H19N3O2S2/c1-3-12-28-21-11-10-16(30-2)14-23(21)32-25(28)27-24(29)18-15-20(22-9-6-13-31-22)26-19-8-5-4-7-17(18)19/h3-11,13-15H,1,12H2,2H3/b27-25- |
| InChIKey | FVHHBRXVBWSFOF-RFBIWTDZSA-N |
| XLogP | 5.92 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|