C15H14N2O4S4 — CID 40892434
N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide (PubChem CID 40892434) has the molecular formula C15H14N2O4S4 and a molecular weight of 414.56 g/mol. Its IUPAC name is N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide.
| Compound Name | N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 40892434 |
| Molecular Formula | C15H14N2O4S4 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide |
| SMILES | C=CCn1c(=NS(=O)(=O)c2cccs2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C15H14N2O4S4/c1-3-8-17-12-7-6-11(24(2,18)19)10-13(12)23-15(17)16-25(20,21)14-5-4-9-22-14/h3-7,9-10H,1,8H2,2H3 |
| InChIKey | CSEHZDAHBRSDRE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|