C14H11N3O4S3 — CID 40892430
N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide (PubChem CID 40892430) has the molecular formula C14H11N3O4S3 and a molecular weight of 381.46 g/mol. Its IUPAC name is N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide.
| Compound Name | N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 40892430 |
| Molecular Formula | C14H11N3O4S3 |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide |
| SMILES | C=CCn1c(=NS(=O)(=O)c2cccs2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C14H11N3O4S3/c1-2-7-16-11-6-5-10(17(18)19)9-12(11)23-14(16)15-24(20,21)13-4-3-8-22-13/h2-6,8-9H,1,7H2 |
| InChIKey | PBBFQYCKMSLQEN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|