C17H12BrN3O3S — CID 4104058
4-bromo-N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 4104058) has the molecular formula C17H12BrN3O3S and a molecular weight of 418.27 g/mol. Its IUPAC name is 4-bromo-N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-bromo-N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 4104058 |
| Molecular Formula | C17H12BrN3O3S |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | 4-bromo-N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(Br)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H12BrN3O3S/c1-2-9-20-14-8-7-13(21(23)24)10-15(14)25-17(20)19-16(22)11-3-5-12(18)6-4-11/h2-8,10H,1,9H2/b19-17- |
| InChIKey | JVOLKBFXMKMJCY-ZPHPHTNESA-N |
| XLogP | 4.30 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|