C17H16N2O3S2 — CID 40849401
N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide (PubChem CID 40849401) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide.
| Compound Name | N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 40849401 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide |
| SMILES | C=CCn1c(=NS(=O)(=O)c2ccccc2)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C17H16N2O3S2/c1-3-11-19-15-10-9-13(22-2)12-16(15)23-17(19)18-24(20,21)14-7-5-4-6-8-14/h3-10,12H,1,11H2,2H3 |
| InChIKey | AKNBBCNPZPMJLO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|