C15H13ClN2O3S3 — CID 16938334
(NZ)-5-chloro-N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide (PubChem CID 16938334) has the molecular formula C15H13ClN2O3S3 and a molecular weight of 400.93 g/mol. Its IUPAC name is (NZ)-5-chloro-N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide.
| Compound Name | (NZ)-5-chloro-N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 16938334 |
| Molecular Formula | C15H13ClN2O3S3 |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | (NZ)-5-chloro-N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide |
| SMILES | C=CCn1/c(=N/S(=O)(=O)c2ccc(Cl)s2)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C15H13ClN2O3S3/c1-3-8-18-11-5-4-10(21-2)9-12(11)22-15(18)17-24(19,20)14-7-6-13(16)23-14/h3-7,9H,1,8H2,2H3/b17-15- |
| InChIKey | RNCRZQUPZGNCRB-ICFOKQHNSA-N |
| XLogP | 3.90 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|