C19H20N2O5S2 — CID 16937547
(NZ)-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide (PubChem CID 16937547) has the molecular formula C19H20N2O5S2 and a molecular weight of 420.51 g/mol. Its IUPAC name is (NZ)-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide.
| Compound Name | (NZ)-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 16937547 |
| Molecular Formula | C19H20N2O5S2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | (NZ)-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide |
| SMILES | C=CCn1/c(=N/S(=O)(=O)c2ccc(OC)cc2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C19H20N2O5S2/c1-5-10-21-15-11-16(25-3)17(26-4)12-18(15)27-19(21)20-28(22,23)14-8-6-13(24-2)7-9-14/h5-9,11-12H,1,10H2,2-4H3/b20-19- |
| InChIKey | QIDGLVXUEHVZJX-VXPUYCOJSA-N |
| XLogP | 3.20 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|