C28H23N3OS — CID 43944033
N-(4,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenylquinoline-4-carboxamide (PubChem CID 43944033) has the molecular formula C28H23N3OS and a molecular weight of 449.58 g/mol. Its IUPAC name is N-(4,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(4,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 43944033 |
| Molecular Formula | C28H23N3OS |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-(4,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenylquinoline-4-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(-c3ccccc3)nc3ccccc23)sc2cc(C)cc(C)c21 |
| InChI | InChI=1S/C28H23N3OS/c1-4-14-31-26-19(3)15-18(2)16-25(26)33-28(31)30-27(32)22-17-24(20-10-6-5-7-11-20)29-23-13-9-8-12-21(22)23/h4-13,15-17H,1,14H2,2-3H3/b30-28- |
| InChIKey | VIPCFPMTZITEFE-HYOGKJQXSA-N |
| XLogP | 6.46 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|