C19H13FN4OS — CID 43943489
N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)quinoxaline-2-carboxamide (PubChem CID 43943489) has the molecular formula C19H13FN4OS and a molecular weight of 364.41 g/mol. Its IUPAC name is N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)quinoxaline-2-carboxamide.
| Compound Name | N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 43943489 |
| Molecular Formula | C19H13FN4OS |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)quinoxaline-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cnc3ccccc3n2)sc2cccc(F)c21 |
| InChI | InChI=1S/C19H13FN4OS/c1-2-10-24-17-12(20)6-5-9-16(17)26-19(24)23-18(25)15-11-21-13-7-3-4-8-14(13)22-15/h2-9,11H,1,10H2/b23-19- |
| InChIKey | ADDOCASDBXXXAY-NMWGTECJSA-N |
| XLogP | 3.71 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|