C21H18N4OS — CID 43980464
N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)quinoxaline-2-carboxamide (PubChem CID 43980464) has the molecular formula C21H18N4OS and a molecular weight of 374.47 g/mol. Its IUPAC name is N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)quinoxaline-2-carboxamide.
| Compound Name | N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 43980464 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)quinoxaline-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cnc3ccccc3n2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C21H18N4OS/c1-4-9-25-18-10-13(2)14(3)11-19(18)27-21(25)24-20(26)17-12-22-15-7-5-6-8-16(15)23-17/h4-8,10-12H,1,9H2,2-3H3/b24-21- |
| InChIKey | PSZBIVBFPJMLJJ-FLFQWRMESA-N |
| XLogP | 4.19 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|