C18H13N3OS2 — CID 3524164
N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-2-carboxamide (PubChem CID 3524164) has the molecular formula C18H13N3OS2 and a molecular weight of 351.46 g/mol. Its IUPAC name is N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 3524164 |
| Molecular Formula | C18H13N3OS2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2nc3ccccc3s2)sc2ccccc21 |
| InChI | InChI=1S/C18H13N3OS2/c1-2-11-21-13-8-4-6-10-15(13)24-18(21)20-16(22)17-19-12-7-3-5-9-14(12)23-17/h2-10H,1,11H2/b20-18- |
| InChIKey | PLJPDCWSPPEKJU-ZZEZOPTASA-N |
| XLogP | 4.24 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|