C20H20N2O3S2 — CID 41148907
4-propan-2-ylsulfonyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 41148907) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 4-propan-2-ylsulfonyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-propan-2-ylsulfonyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 41148907 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 4-propan-2-ylsulfonyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)C(C)C)cc2)sc2ccccc21 |
| InChI | InChI=1S/C20H20N2O3S2/c1-4-13-22-17-7-5-6-8-18(17)26-20(22)21-19(23)15-9-11-16(12-10-15)27(24,25)14(2)3/h4-12,14H,1,13H2,2-3H3/b21-20- |
| InChIKey | RBXJIQBHIHDASI-MRCUWXFGSA-N |
| XLogP | 3.81 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|