C21H22N2O3S3 — CID 41149188
N-(6-methylsulfanyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-propan-2-ylsulfonylbenzamide (PubChem CID 41149188) has the molecular formula C21H22N2O3S3 and a molecular weight of 446.62 g/mol. Its IUPAC name is N-(6-methylsulfanyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-propan-2-ylsulfonylbenzamide.
| Compound Name | N-(6-methylsulfanyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-propan-2-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 41149188 |
| Molecular Formula | C21H22N2O3S3 |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | N-(6-methylsulfanyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-propan-2-ylsulfonylbenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)C(C)C)cc2)sc2cc(SC)ccc21 |
| InChI | InChI=1S/C21H22N2O3S3/c1-5-12-23-18-11-8-16(27-4)13-19(18)28-21(23)22-20(24)15-6-9-17(10-7-15)29(25,26)14(2)3/h5-11,13-14H,1,12H2,2-4H3/b22-21- |
| InChIKey | LBGNYBALUQQJOD-DQRAZIAOSA-N |
| XLogP | 4.53 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|