C20H15N3O2S — CID 43943258
5-phenyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,2-oxazole-3-carboxamide (PubChem CID 43943258) has the molecular formula C20H15N3O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is 5-phenyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-phenyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 43943258 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 5-phenyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,2-oxazole-3-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(-c3ccccc3)on2)sc2ccccc21 |
| InChI | InChI=1S/C20H15N3O2S/c1-2-12-23-16-10-6-7-11-18(16)26-20(23)21-19(24)15-13-17(25-22-15)14-8-4-3-5-9-14/h2-11,13H,1,12H2/b21-20- |
| InChIKey | VLXFTKHPENAIGS-MRCUWXFGSA-N |
| XLogP | 4.28 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|