C19H13N3O3S2 — CID 40508731
N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-1,3-benzothiazole-2-carboxamide (PubChem CID 40508731) has the molecular formula C19H13N3O3S2 and a molecular weight of 395.47 g/mol. Its IUPAC name is N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 40508731 |
| Molecular Formula | C19H13N3O3S2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-1,3-benzothiazole-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2nc3ccccc3s2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C19H13N3O3S2/c1-2-7-22-12-8-13-14(25-10-24-13)9-16(12)27-19(22)21-17(23)18-20-11-5-3-4-6-15(11)26-18/h2-6,8-9H,1,7,10H2/b21-19- |
| InChIKey | YJUTVIXHESPLQB-VZCXRCSSSA-N |
| XLogP | 3.97 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|