C20H18N2O5S2 — CID 42523785
2-benzylsulfonyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)acetamide (PubChem CID 42523785) has the molecular formula C20H18N2O5S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-benzylsulfonyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)acetamide.
| Compound Name | 2-benzylsulfonyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)acetamide |
|---|---|
| PubChem CID | 42523785 |
| Molecular Formula | C20H18N2O5S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2-benzylsulfonyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)CS(=O)(=O)Cc2ccccc2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C20H18N2O5S2/c1-2-8-22-15-9-16-17(27-13-26-16)10-18(15)28-20(22)21-19(23)12-29(24,25)11-14-6-4-3-5-7-14/h2-7,9-10H,1,8,11-13H2/b21-20- |
| InChIKey | CIEWKNNTAJHZMT-MRCUWXFGSA-N |
| XLogP | 2.66 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|